C23H38O5 — CID 53477519
1,3-dihydroxypropan-2-yl (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate (PubChem CID 53477519) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 53477519 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C\C/C=C\CCCC(=O)OC(CO)CO |
| InChI | InChI=1S/C23H38O5/c1-2-3-4-5-10-13-16-21(26)17-14-11-8-6-7-9-12-15-18-23(27)28-22(19-24)20-25/h7-11,13-14,17,21-22,24-26H,2-6,12,15-16,18-20H2,1H3/b9-7-,11-8-,13-10-,17-14+/t21-/m0/s1 |
| InChIKey | VOBREYBFMGVDHP-KUJNIBRASA-N |
| XLogP | 4.00 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|