C44H81NO7P+ — CID 53478830
2-[hydroxy-[2-[(1Z,9Z)-octadeca-1,9-dienoxy]-3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 53478830) has the molecular formula C44H81NO7P+ and a molecular weight of 767.11 g/mol. Its IUPAC name is 2-[hydroxy-[2-[(1Z,9Z)-octadeca-1,9-dienoxy]-3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-[(1Z,9Z)-octadeca-1,9-dienoxy]-3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 53478830 |
| Molecular Formula | C44H81NO7P+ |
| Molecular Weight | 767.11 g/mol |
| Exact Mass | 766.57 |
| IUPAC Name | 2-[hydroxy-[2-[(1Z,9Z)-octadeca-1,9-dienoxy]-3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)O/C=C\CCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C44H80NO7P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39-49-43(42-52-53(47,48)51-40-38-45(3,4)5)41-50-44(46)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h15,17,20-23,27,29,36,39,43H,6-14,16,18-19,24-26,28,30-35,37-38,40-42H2,1-5H3/p+1/b17-15-,22-20-,23-21-,29-27-,39-36- |
| InChIKey | KNUHCOXKVDQBIW-UPRXZTSASA-O |
| XLogP | 12.51 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.11 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|