C44H81NO7P+ — CID 53480750
2-[hydroxy-[3-[(1Z,11Z)-octadeca-1,11-dienoxy]-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 53480750) has the molecular formula C44H81NO7P+ and a molecular weight of 767.11 g/mol. Its IUPAC name is 2-[hydroxy-[3-[(1Z,11Z)-octadeca-1,11-dienoxy]-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[3-[(1Z,11Z)-octadeca-1,11-dienoxy]-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 53480750 |
| Molecular Formula | C44H81NO7P+ |
| Molecular Weight | 767.11 g/mol |
| Exact Mass | 766.57 |
| IUPAC Name | 2-[hydroxy-[3-[(1Z,11Z)-octadeca-1,11-dienoxy]-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(CO/C=C\CCCCCCCC/C=C\CCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C44H80NO7P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39-49-41-43(42-51-53(47,48)50-40-38-45(3,4)5)52-44(46)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h9,11,15-18,21,23,36,39,43H,6-8,10,12-14,19-20,22,24-35,37-38,40-42H2,1-5H3/p+1/b11-9-,17-15-,18-16-,23-21-,39-36- |
| InChIKey | JPNFMUKASUYGCK-ZXWSQSGJSA-O |
| XLogP | 12.51 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.11 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|