C13H21F — CID 534813
1-(3,3-dimethylbut-1-ynyl)-1-fluoro-2,2,3,3-tetramethylcyclopropane (PubChem CID 534813) has the molecular formula C13H21F and a molecular weight of 196.31 g/mol. Its IUPAC name is 1-(3,3-dimethylbut-1-ynyl)-1-fluoro-2,2,3,3-tetramethylcyclopropane.
| Compound Name | 1-(3,3-dimethylbut-1-ynyl)-1-fluoro-2,2,3,3-tetramethylcyclopropane |
|---|---|
| PubChem CID | 534813 |
| Molecular Formula | C13H21F |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(3,3-dimethylbut-1-ynyl)-1-fluoro-2,2,3,3-tetramethylcyclopropane |
| SMILES | CC(C)(C)C#CC1(F)C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H21F/c1-10(2,3)8-9-13(14)11(4,5)12(13,6)7/h1-7H3 |
| InChIKey | ROZDKZOBYQFRDS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|