C20H32O6 — CID 53481368
4-[3-[[(1S,2S,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]methyl]oxiran-2-yl]butanoic acid (PubChem CID 53481368) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-[3-[[(1S,2S,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]methyl]oxiran-2-yl]butanoic acid.
| Compound Name | 4-[3-[[(1S,2S,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]methyl]oxiran-2-yl]butanoic acid |
|---|---|
| PubChem CID | 53481368 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 4-[3-[[(1S,2S,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]methyl]oxiran-2-yl]butanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O)C(=O)C[C@@H]1O |
| InChI | InChI=1S/C20H32O6/c1-2-3-4-6-13(21)9-10-14-15(17(23)12-16(14)22)11-19-18(26-19)7-5-8-20(24)25/h9-10,13-16,18-19,21-22H,2-8,11-12H2,1H3,(H,24,25)/b10-9+/t13-,14-,15-,16-,18?,19?/m0/s1 |
| InChIKey | CBOBGOJUDRNUHE-HHECASJMSA-N |
| XLogP | 2.46 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|