C11H15NO2 — CID 53481438
(1R)-1,2-dimethyl-3,4-dihydro-1H-isoquinoline-5,6-diol (PubChem CID 53481438) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (1R)-1,2-dimethyl-3,4-dihydro-1H-isoquinoline-5,6-diol.
| Compound Name | (1R)-1,2-dimethyl-3,4-dihydro-1H-isoquinoline-5,6-diol |
|---|---|
| PubChem CID | 53481438 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (1R)-1,2-dimethyl-3,4-dihydro-1H-isoquinoline-5,6-diol |
| SMILES | C[C@@H]1c2ccc(O)c(O)c2CCN1C |
| InChI | InChI=1S/C11H15NO2/c1-7-8-3-4-10(13)11(14)9(8)5-6-12(7)2/h3-4,7,13-14H,5-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | AASFZUCQPYZSBW-SSDOTTSWSA-N |
| XLogP | 1.65 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|