About trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium
trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium (PubChem CID 53481656) has the molecular formula C23H44NO2+
and a molecular weight of 366.61 g/mol. Its IUPAC name is trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium.
Molecular Properties
| Compound Name | trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium |
| PubChem CID | 53481656 |
| Molecular Formula | C23H44NO2+ |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 366.34 |
| IUPAC Name | trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C23H44NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(25)26-22-21-24(2,3)4/h9-10,12-13H,5-8,11,14-22H2,1-4H3/q+1/b10-9-,13-12- |
| InChIKey | FDCFEKFQGUEBOI-UTJQPWESSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium?
The IUPAC name of trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium (CID 53481656) is trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium.
What is the SMILES notation for trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium?
The canonical SMILES for trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium is CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC[N+](C)(C)C.
What is the InChIKey of trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium?
The InChIKey is FDCFEKFQGUEBOI-UTJQPWESSA-N. The full InChI is InChI=1S/C23H44NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(25)26-22-21-24(2,3)4/h9-10,12-13H,5-8,11,14-22H2,1-4H3/q+1/b10-9-,13-12-.
What are the key properties of trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium?
trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium has a molecular weight of 366.61 g/mol, XLogP of 6.05, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]azanium is sourced from PubChem (CID 53481656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).