About (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride
(3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride (PubChem CID 53482061) has the molecular formula C6H16Cl2N2
and a molecular weight of 187.11 g/mol. Its IUPAC name is (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride |
| PubChem CID | 53482061 |
| Molecular Formula | C6H16Cl2N2 |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride |
| SMILES | CN(C)[C@H]1CCNC1.Cl.Cl |
| InChI | InChI=1S/C6H14N2.2ClH/c1-8(2)6-3-4-7-5-6;;/h6-7H,3-5H2,1-2H3;2*1H/t6-;;/m0../s1 |
| InChIKey | LCPKWRSLMCUOOZ-ILKKLZGPSA-N |
| XLogP | 0.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride?
The IUPAC name of (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride (CID 53482061) is (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride.
What is the SMILES notation for (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride?
The canonical SMILES for (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride is CN(C)[C@H]1CCNC1.Cl.Cl.
What is the InChIKey of (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride?
The InChIKey is LCPKWRSLMCUOOZ-ILKKLZGPSA-N. The full InChI is InChI=1S/C6H14N2.2ClH/c1-8(2)6-3-4-7-5-6;;/h6-7H,3-5H2,1-2H3;2*1H/t6-;;/m0../s1.
What are the key properties of (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride?
(3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride has a molecular weight of 187.11 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N,N-dimethylpyrrolidin-3-amine;dihydrochloride is sourced from PubChem (CID 53482061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).