C14H25BClNO2 — CID 53482063
(2S)-2-[(1R,2S,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride (PubChem CID 53482063) has the molecular formula C14H25BClNO2 and a molecular weight of 285.62 g/mol. Its IUPAC name is (2S)-2-[(1R,2S,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride.
| Compound Name | (2S)-2-[(1R,2S,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 53482063 |
| Molecular Formula | C14H25BClNO2 |
| Molecular Weight | 285.62 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2S)-2-[(1R,2S,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB([C@H]4CCCN4)O[C@@]3(C)[C@@H]1C2.Cl |
| InChI | InChI=1S/C14H24BNO2.ClH/c1-13(2)9-7-10(13)14(3)11(8-9)17-15(18-14)12-5-4-6-16-12;/h9-12,16H,4-8H2,1-3H3;1H/t9-,10-,11+,12-,14+;/m1./s1 |
| InChIKey | OVVMNBVQOPZMPY-NABUFDMJSA-N |
| XLogP | 2.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|