C21H14F3N5OS — CID 53482153
[3-[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone (PubChem CID 53482153) has the molecular formula C21H14F3N5OS and a molecular weight of 441.44 g/mol. Its IUPAC name is [3-[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone.
| Compound Name | [3-[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 53482153 |
| Molecular Formula | C21H14F3N5OS |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | [3-[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCn2c(nnc2-c2csc(-c3ccc(F)cc3F)n2)C1 |
| InChI | InChI=1S/C21H14F3N5OS/c22-13-3-1-12(2-4-13)21(30)28-7-8-29-18(10-28)26-27-19(29)17-11-31-20(25-17)15-6-5-14(23)9-16(15)24/h1-6,9,11H,7-8,10H2 |
| InChIKey | KJOKOMSEABJWBI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |