C21H14Cl2FN5OS — CID 53482154
[3-[2-(2,3-dichlorophenyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone (PubChem CID 53482154) has the molecular formula C21H14Cl2FN5OS and a molecular weight of 474.35 g/mol. Its IUPAC name is [3-[2-(2,3-dichlorophenyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone.
| Compound Name | [3-[2-(2,3-dichlorophenyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 53482154 |
| Molecular Formula | C21H14Cl2FN5OS |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | [3-[2-(2,3-dichlorophenyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCn2c(nnc2-c2csc(-c3cccc(Cl)c3Cl)n2)C1 |
| InChI | InChI=1S/C21H14Cl2FN5OS/c22-15-3-1-2-14(18(15)23)20-25-16(11-31-20)19-27-26-17-10-28(8-9-29(17)19)21(30)12-4-6-13(24)7-5-12/h1-7,11H,8-10H2 |
| InChIKey | UNIUZEWHIXQDOP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |