C34H31F2N5O4S — CID 53482224
1-N'-[3-fluoro-4-[2-[5-[2-(2-methoxyethylamino)ethyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 53482224) has the molecular formula C34H31F2N5O4S and a molecular weight of 643.72 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[2-[5-[2-(2-methoxyethylamino)ethyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[2-[5-[2-(2-methoxyethylamino)ethyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 53482224 |
| Molecular Formula | C34H31F2N5O4S |
| Molecular Weight | 643.72 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | 1-N'-[3-fluoro-4-[2-[5-[2-(2-methoxyethylamino)ethyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COCCNCCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)C5(C(=O)Nc6ccc(F)cc6)CC5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C34H31F2N5O4S/c1-44-17-16-37-14-10-21-2-8-26(39-20-21)30-19-27-31(46-30)29(11-15-38-27)45-28-9-7-24(18-25(28)36)41-33(43)34(12-13-34)32(42)40-23-5-3-22(35)4-6-23/h2-9,11,15,18-20,37H,10,12-14,16-17H2,1H3,(H,40,42)(H,41,43) |
| InChIKey | NMXIXZLNLQPVED-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|