C13H25NO5Si — CID 53483165
[(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-yl] N-hydroxycarbamate (PubChem CID 53483165) has the molecular formula C13H25NO5Si and a molecular weight of 303.43 g/mol. Its IUPAC name is [(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-yl] N-hydroxycarbamate.
| Compound Name | [(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-yl] N-hydroxycarbamate |
|---|---|
| PubChem CID | 53483165 |
| Molecular Formula | C13H25NO5Si |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-yl] N-hydroxycarbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OCC=C[C@H]1OC(=O)NO |
| InChI | InChI=1S/C13H25NO5Si/c1-13(2,3)20(4,5)18-9-11-10(7-6-8-17-11)19-12(15)14-16/h6-7,10-11,16H,8-9H2,1-5H3,(H,14,15)/t10-,11-/m1/s1 |
| InChIKey | CGXIWBFUVRTWNN-GHMZBOCLSA-N |
| XLogP | 2.45 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|