C16H11F6NO — CID 53483171
2,2,2-trifluoro-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]ethanimine (PubChem CID 53483171) has the molecular formula C16H11F6NO and a molecular weight of 347.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]ethanimine.
| Compound Name | 2,2,2-trifluoro-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]ethanimine |
|---|---|
| PubChem CID | 53483171 |
| Molecular Formula | C16H11F6NO |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]ethanimine |
| SMILES | COc1ccc(/N=C(/c2ccc(C(F)(F)F)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F6NO/c1-24-13-8-6-12(7-9-13)23-14(16(20,21)22)10-2-4-11(5-3-10)15(17,18)19/h2-9H,1H3/b23-14- |
| InChIKey | GKDTUPNFEIWWPT-UCQKPKSFSA-N |
| XLogP | 5.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|