C13H22FNO4 — CID 53483369
prop-2-enyl N-[(3S,4S,6S)-6-fluoro-4-methoxyoxan-3-yl]-N-propan-2-ylcarbamate (PubChem CID 53483369) has the molecular formula C13H22FNO4 and a molecular weight of 275.32 g/mol. Its IUPAC name is prop-2-enyl N-[(3S,4S,6S)-6-fluoro-4-methoxyoxan-3-yl]-N-propan-2-ylcarbamate.
| Compound Name | prop-2-enyl N-[(3S,4S,6S)-6-fluoro-4-methoxyoxan-3-yl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 53483369 |
| Molecular Formula | C13H22FNO4 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | prop-2-enyl N-[(3S,4S,6S)-6-fluoro-4-methoxyoxan-3-yl]-N-propan-2-ylcarbamate |
| SMILES | C=CCOC(=O)N(C(C)C)[C@H]1CO[C@@H](F)C[C@@H]1OC |
| InChI | InChI=1S/C13H22FNO4/c1-5-6-18-13(16)15(9(2)3)10-8-19-12(14)7-11(10)17-4/h5,9-12H,1,6-8H2,2-4H3/t10-,11-,12+/m0/s1 |
| InChIKey | TYPCEUYPTFRVMQ-SDDRHHMPSA-N |
| XLogP | 2.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|