C18H26O5Si — CID 53483588
dimethyl (3aE,8Z)-5-oxo-4-trimethylsilyl-3,6,7,9a-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate (PubChem CID 53483588) has the molecular formula C18H26O5Si and a molecular weight of 350.49 g/mol. Its IUPAC name is dimethyl (3aE,8Z)-5-oxo-4-trimethylsilyl-3,6,7,9a-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aE,8Z)-5-oxo-4-trimethylsilyl-3,6,7,9a-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 53483588 |
| Molecular Formula | C18H26O5Si |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | dimethyl (3aE,8Z)-5-oxo-4-trimethylsilyl-3,6,7,9a-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C/C2=C(\[Si](C)(C)C)C(=O)CC/C=C\C2C1 |
| InChI | InChI=1S/C18H26O5Si/c1-22-16(20)18(17(21)23-2)10-12-8-6-7-9-14(19)15(13(12)11-18)24(3,4)5/h6,8,12H,7,9-11H2,1-5H3/b8-6-,15-13+ |
| InChIKey | DRVOWFWAHZUFJJ-MZIYWGQSSA-N |
| XLogP | 2.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|