C12H24O3Si2 — CID 53483590
4-(2,2,5,5-tetramethyl-1,2,5-oxadisilol-3-yl)butyl acetate (PubChem CID 53483590) has the molecular formula C12H24O3Si2 and a molecular weight of 272.49 g/mol. Its IUPAC name is 4-(2,2,5,5-tetramethyl-1,2,5-oxadisilol-3-yl)butyl acetate.
| Compound Name | 4-(2,2,5,5-tetramethyl-1,2,5-oxadisilol-3-yl)butyl acetate |
|---|---|
| PubChem CID | 53483590 |
| Molecular Formula | C12H24O3Si2 |
| Molecular Weight | 272.49 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-(2,2,5,5-tetramethyl-1,2,5-oxadisilol-3-yl)butyl acetate |
| SMILES | CC(=O)OCCCCC1=C[Si](C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C12H24O3Si2/c1-11(13)14-9-7-6-8-12-10-16(2,3)15-17(12,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | PABHVKAPNADKOW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|