About (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol
(1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol (PubChem CID 53483973) has the molecular formula C18H28O4
and a molecular weight of 308.42 g/mol. Its IUPAC name is (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol.
Molecular Properties
| Compound Name | (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol |
| PubChem CID | 53483973 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol |
| SMILES | CCCCCCCC[C@]1(OC)O[C@H](OC)c2c(O)cccc21 |
| InChI | InChI=1S/C18H28O4/c1-4-5-6-7-8-9-13-18(21-3)14-11-10-12-15(19)16(14)17(20-2)22-18/h10-12,17,19H,4-9,13H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | VKMFJAVAGSMZBP-ROUUACIJSA-N |
| XLogP | 4.62 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol?
The IUPAC name of (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol (CID 53483973) is (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol.
What is the SMILES notation for (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol?
The canonical SMILES for (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol is CCCCCCCC[C@]1(OC)O[C@H](OC)c2c(O)cccc21.
What is the InChIKey of (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol?
The InChIKey is VKMFJAVAGSMZBP-ROUUACIJSA-N. The full InChI is InChI=1S/C18H28O4/c1-4-5-6-7-8-9-13-18(21-3)14-11-10-12-15(19)16(14)17(20-2)22-18/h10-12,17,19H,4-9,13H2,1-3H3/t17-,18-/m0/s1.
What are the key properties of (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol?
(1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol has a molecular weight of 308.42 g/mol, XLogP of 4.62, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3S)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol is sourced from PubChem (CID 53483973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).