C56H56N4O6 — CID 53484028
2,3-dihexyl-5,10,15,20-tetrakis(3-hydroxyphenyl)-22,24-dihydroporphyrin-2,3-diol (PubChem CID 53484028) has the molecular formula C56H56N4O6 and a molecular weight of 881.09 g/mol. Its IUPAC name is 2,3-dihexyl-5,10,15,20-tetrakis(3-hydroxyphenyl)-22,24-dihydroporphyrin-2,3-diol.
| Compound Name | 2,3-dihexyl-5,10,15,20-tetrakis(3-hydroxyphenyl)-22,24-dihydroporphyrin-2,3-diol |
|---|---|
| PubChem CID | 53484028 |
| Molecular Formula | C56H56N4O6 |
| Molecular Weight | 881.09 g/mol |
| Exact Mass | 880.42 |
| IUPAC Name | 2,3-dihexyl-5,10,15,20-tetrakis(3-hydroxyphenyl)-22,24-dihydroporphyrin-2,3-diol |
| SMILES | CCCCCCC1(O)c2nc(c(-c3cccc(O)c3)c3ccc([nH]3)c(-c3cccc(O)c3)c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c2-c2cccc(O)c2)C=C3)C1(O)CCCCCC |
| InChI | InChI=1S/C56H56N4O6/c1-3-5-7-9-29-55(65)53-51(37-17-13-21-41(63)33-37)47-27-25-45(58-47)49(35-15-11-19-39(61)31-35)43-23-24-44(57-43)50(36-16-12-20-40(62)32-36)46-26-28-48(59-46)52(38-18-14-22-42(64)34-38)54(60-53)56(55,66)30-10-8-6-4-2/h11-28,31-34,58-59,61-66H,3-10,29-30H2,1-2H3/b49-43-,49-45-,50-44-,50-46-,51-47-,52-48-,53-51-,54-52- |
| InChIKey | BBZYPNYYJKFNPX-MTYOREHCSA-N |
| XLogP | 12.99 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.09 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|