About (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride
(1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride (PubChem CID 53484036) has the molecular formula C18H22ClNO
and a molecular weight of 303.83 g/mol. Its IUPAC name is (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride.
Molecular Properties
| Compound Name | (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride |
| PubChem CID | 53484036 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride |
| SMILES | Cc1ccc([C@@H](O)C[C@H]2c3ccccc3CN2C)cc1.Cl |
| InChI | InChI=1S/C18H21NO.ClH/c1-13-7-9-14(10-8-13)18(20)11-17-16-6-4-3-5-15(16)12-19(17)2;/h3-10,17-18,20H,11-12H2,1-2H3;1H/t17-,18-;/m0./s1 |
| InChIKey | YLBKGAFKIIKWGT-APTPAJQOSA-N |
| XLogP | 4.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride?
The IUPAC name of (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride (CID 53484036) is (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride.
What is the SMILES notation for (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride?
The canonical SMILES for (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride is Cc1ccc([C@@H](O)C[C@H]2c3ccccc3CN2C)cc1.Cl.
What is the InChIKey of (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride?
The InChIKey is YLBKGAFKIIKWGT-APTPAJQOSA-N. The full InChI is InChI=1S/C18H21NO.ClH/c1-13-7-9-14(10-8-13)18(20)11-17-16-6-4-3-5-15(16)12-19(17)2;/h3-10,17-18,20H,11-12H2,1-2H3;1H/t17-,18-;/m0./s1.
What are the key properties of (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride?
(1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride has a molecular weight of 303.83 g/mol, XLogP of 4.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-[(1S)-2-methyl-1,3-dihydroisoindol-1-yl]-1-(4-methylphenyl)ethanol;hydrochloride is sourced from PubChem (CID 53484036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).