C24H32N2O6 — CID 53484107
N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]hexane-1,6-diamine (PubChem CID 53484107) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]hexane-1,6-diamine.
| Compound Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 53484107 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]hexane-1,6-diamine |
| SMILES | COc1cc(CNCCCCCCNCc2cc(OC)c3c(c2)OCO3)cc2c1OCO2 |
| InChI | InChI=1S/C24H32N2O6/c1-27-19-9-17(11-21-23(19)31-15-29-21)13-25-7-5-3-4-6-8-26-14-18-10-20(28-2)24-22(12-18)30-16-32-24/h9-12,25-26H,3-8,13-16H2,1-2H3 |
| InChIKey | TZMDWCJQVQRVMY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|