C26H36N2O6 — CID 53484125
N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]octane-1,8-diamine (PubChem CID 53484125) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]octane-1,8-diamine.
| Compound Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]octane-1,8-diamine |
|---|---|
| PubChem CID | 53484125 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]octane-1,8-diamine |
| SMILES | COc1cc(CNCCCCCCCCNCc2cc(OC)c3c(c2)OCO3)cc2c1OCO2 |
| InChI | InChI=1S/C26H36N2O6/c1-29-21-11-19(13-23-25(21)33-17-31-23)15-27-9-7-5-3-4-6-8-10-28-16-20-12-22(30-2)26-24(14-20)32-18-34-26/h11-14,27-28H,3-10,15-18H2,1-2H3 |
| InChIKey | HBFWQMXRCCOIBQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|