C27H38N2O6 — CID 53484126
N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]nonane-1,9-diamine (PubChem CID 53484126) has the molecular formula C27H38N2O6 and a molecular weight of 486.61 g/mol. Its IUPAC name is N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]nonane-1,9-diamine.
| Compound Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]nonane-1,9-diamine |
|---|---|
| PubChem CID | 53484126 |
| Molecular Formula | C27H38N2O6 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]nonane-1,9-diamine |
| SMILES | COc1cc(CNCCCCCCCCCNCc2cc(OC)c3c(c2)OCO3)cc2c1OCO2 |
| InChI | InChI=1S/C27H38N2O6/c1-30-22-12-20(14-24-26(22)34-18-32-24)16-28-10-8-6-4-3-5-7-9-11-29-17-21-13-23(31-2)27-25(15-21)33-19-35-27/h12-15,28-29H,3-11,16-19H2,1-2H3 |
| InChIKey | XSHRVWOVUGATJH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|