C27H44O6 — CID 53484199
[(2S,3S,4R,5R)-2-[[(1S,4S,4aR,6S,8aS)-4,4a-dimethyl-6-[(2E)-6-methylhepta-2,5-dien-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate (PubChem CID 53484199) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2-[[(1S,4S,4aR,6S,8aS)-4,4a-dimethyl-6-[(2E)-6-methylhepta-2,5-dien-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-2-[[(1S,4S,4aR,6S,8aS)-4,4a-dimethyl-6-[(2E)-6-methylhepta-2,5-dien-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 53484199 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | [(2S,3S,4R,5R)-2-[[(1S,4S,4aR,6S,8aS)-4,4a-dimethyl-6-[(2E)-6-methylhepta-2,5-dien-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](O[C@H]2CC[C@H](C)[C@@]3(C)C[C@@H](/C(C)=C/CC=C(C)C)CC[C@H]23)OC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H44O6/c1-16(2)8-7-9-17(3)20-11-12-21-23(13-10-18(4)27(21,6)14-20)33-26-25(32-19(5)28)24(30)22(29)15-31-26/h8-9,18,20-26,29-30H,7,10-15H2,1-6H3/b17-9+/t18-,20-,21+,22+,23-,24+,25-,26-,27+/m0/s1 |
| InChIKey | IDBOOCJKJVAGAO-DESIZGQRSA-N |
| XLogP | 4.54 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|