About 3-(3-bromophenyl)oxetane
3-(3-bromophenyl)oxetane (PubChem CID 53484319) has the molecular formula C9H9BrO
and a molecular weight of 213.07 g/mol. Its IUPAC name is 3-(3-bromophenyl)oxetane.
Molecular Properties
| Compound Name | 3-(3-bromophenyl)oxetane |
| PubChem CID | 53484319 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 3-(3-bromophenyl)oxetane |
| SMILES | Brc1cccc(C2COC2)c1 |
| InChI | InChI=1S/C9H9BrO/c10-9-3-1-2-7(4-9)8-5-11-6-8/h1-4,8H,5-6H2 |
| InChIKey | IKNHAXGIHOUCCX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3-bromophenyl)oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromophenyl)oxetane?
The IUPAC name of 3-(3-bromophenyl)oxetane (CID 53484319) is 3-(3-bromophenyl)oxetane.
What is the SMILES notation for 3-(3-bromophenyl)oxetane?
The canonical SMILES for 3-(3-bromophenyl)oxetane is Brc1cccc(C2COC2)c1.
What is the InChIKey of 3-(3-bromophenyl)oxetane?
The InChIKey is IKNHAXGIHOUCCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO/c10-9-3-1-2-7(4-9)8-5-11-6-8/h1-4,8H,5-6H2.
What are the key properties of 3-(3-bromophenyl)oxetane?
3-(3-bromophenyl)oxetane has a molecular weight of 213.07 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)oxetane is sourced from PubChem (CID 53484319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).