About 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid
6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid (PubChem CID 53484369) has the molecular formula C17H23NO6
and a molecular weight of 337.37 g/mol. Its IUPAC name is 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid.
Molecular Properties
| Compound Name | 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid |
| PubChem CID | 53484369 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCON=Cc1ccccc1OCC1OCCO1 |
| InChI | InChI=1S/C17H23NO6/c19-16(20)8-2-1-5-9-24-18-12-14-6-3-4-7-15(14)23-13-17-21-10-11-22-17/h3-4,6-7,12,17H,1-2,5,8-11,13H2,(H,19,20) |
| InChIKey | XCKYWONXNGWBHZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid?
The IUPAC name of 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid (CID 53484369) is 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid.
What is the SMILES notation for 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid?
The canonical SMILES for 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid is O=C(O)CCCCCON=Cc1ccccc1OCC1OCCO1.
What is the InChIKey of 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid?
The InChIKey is XCKYWONXNGWBHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO6/c19-16(20)8-2-1-5-9-24-18-12-14-6-3-4-7-15(14)23-13-17-21-10-11-22-17/h3-4,6-7,12,17H,1-2,5,8-11,13H2,(H,19,20).
What are the key properties of 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid?
6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid has a molecular weight of 337.37 g/mol, XLogP of 2.43, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(1,3-dioxolan-2-ylmethoxy)phenyl]methylideneamino]oxyhexanoic acid is sourced from PubChem (CID 53484369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).