C10H11NO2 — CID 53484480
4-ethyl-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 53484480) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 4-ethyl-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 4-ethyl-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 53484480 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4-ethyl-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CCc1cccc2c1C(O)C(=O)N2 |
| InChI | InChI=1S/C10H11NO2/c1-2-6-4-3-5-7-8(6)9(12)10(13)11-7/h3-5,9,12H,2H2,1H3,(H,11,13) |
| InChIKey | OWEFVBZYSIRPRG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |