About N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride
N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride (PubChem CID 53484495) has the molecular formula C6H12ClF2N
and a molecular weight of 171.62 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride |
| PubChem CID | 53484495 |
| Molecular Formula | C6H12ClF2N |
| Molecular Weight | 171.62 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride |
| SMILES | Cl.FC(F)CNC1CCC1 |
| InChI | InChI=1S/C6H11F2N.ClH/c7-6(8)4-9-5-2-1-3-5;/h5-6,9H,1-4H2;1H |
| InChIKey | MJAXLPOKNMIOML-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.62 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride?
The IUPAC name of N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride (CID 53484495) is N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride.
What is the SMILES notation for N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride?
The canonical SMILES for N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride is Cl.FC(F)CNC1CCC1.
What is the InChIKey of N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride?
The InChIKey is MJAXLPOKNMIOML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2N.ClH/c7-6(8)4-9-5-2-1-3-5;/h5-6,9H,1-4H2;1H.
What are the key properties of N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride?
N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride has a molecular weight of 171.62 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)cyclobutanamine;hydrochloride is sourced from PubChem (CID 53484495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).