About 4-benzylsulfanyloxane
4-benzylsulfanyloxane (PubChem CID 53484657) has the molecular formula C12H16OS
and a molecular weight of 208.33 g/mol. Its IUPAC name is 4-benzylsulfanyloxane.
Molecular Properties
| Compound Name | 4-benzylsulfanyloxane |
| PubChem CID | 53484657 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-benzylsulfanyloxane |
| SMILES | c1ccc(CSC2CCOCC2)cc1 |
| InChI | InChI=1S/C12H16OS/c1-2-4-11(5-3-1)10-14-12-6-8-13-9-7-12/h1-5,12H,6-10H2 |
| InChIKey | DSBJHDGRCCYGEL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzylsulfanyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanyloxane?
The IUPAC name of 4-benzylsulfanyloxane (CID 53484657) is 4-benzylsulfanyloxane.
What is the SMILES notation for 4-benzylsulfanyloxane?
The canonical SMILES for 4-benzylsulfanyloxane is c1ccc(CSC2CCOCC2)cc1.
What is the InChIKey of 4-benzylsulfanyloxane?
The InChIKey is DSBJHDGRCCYGEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS/c1-2-4-11(5-3-1)10-14-12-6-8-13-9-7-12/h1-5,12H,6-10H2.
What are the key properties of 4-benzylsulfanyloxane?
4-benzylsulfanyloxane has a molecular weight of 208.33 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanyloxane is sourced from PubChem (CID 53484657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).