C8H10ClF2N — CID 53484729
(1S)-1-(2,5-difluorophenyl)ethanamine;hydrochloride (PubChem CID 53484729) has the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. Its IUPAC name is (1S)-1-(2,5-difluorophenyl)ethanamine;hydrochloride.
| Compound Name | (1S)-1-(2,5-difluorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 53484729 |
| Molecular Formula | C8H10ClF2N |
| Molecular Weight | 193.62 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | (1S)-1-(2,5-difluorophenyl)ethanamine;hydrochloride |
| SMILES | C[C@H](N)c1cc(F)ccc1F.Cl |
| InChI | InChI=1S/C8H9F2N.ClH/c1-5(11)7-4-6(9)2-3-8(7)10;/h2-5H,11H2,1H3;1H/t5-;/m0./s1 |
| InChIKey | NQFUIZOIKVFLIM-JEDNCBNOSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.62 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |