About 3-bromo-5,6,7,8-tetrahydroquinoline
3-bromo-5,6,7,8-tetrahydroquinoline (PubChem CID 53485154) has the molecular formula C9H10BrN
and a molecular weight of 212.09 g/mol. Its IUPAC name is 3-bromo-5,6,7,8-tetrahydroquinoline.
Molecular Properties
| Compound Name | 3-bromo-5,6,7,8-tetrahydroquinoline |
| PubChem CID | 53485154 |
| Molecular Formula | C9H10BrN |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 3-bromo-5,6,7,8-tetrahydroquinoline |
| SMILES | Brc1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C9H10BrN/c10-8-5-7-3-1-2-4-9(7)11-6-8/h5-6H,1-4H2 |
| InChIKey | FKERWWYCYWMBHC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-5,6,7,8-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5,6,7,8-tetrahydroquinoline?
The IUPAC name of 3-bromo-5,6,7,8-tetrahydroquinoline (CID 53485154) is 3-bromo-5,6,7,8-tetrahydroquinoline.
What is the SMILES notation for 3-bromo-5,6,7,8-tetrahydroquinoline?
The canonical SMILES for 3-bromo-5,6,7,8-tetrahydroquinoline is Brc1cnc2c(c1)CCCC2.
What is the InChIKey of 3-bromo-5,6,7,8-tetrahydroquinoline?
The InChIKey is FKERWWYCYWMBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN/c10-8-5-7-3-1-2-4-9(7)11-6-8/h5-6H,1-4H2.
What are the key properties of 3-bromo-5,6,7,8-tetrahydroquinoline?
3-bromo-5,6,7,8-tetrahydroquinoline has a molecular weight of 212.09 g/mol, XLogP of 2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5,6,7,8-tetrahydroquinoline is sourced from PubChem (CID 53485154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).