C14H13N3O4 — CID 53485391
methyl 3-[(4-methoxybenzoyl)amino]pyrazine-2-carboxylate (PubChem CID 53485391) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is methyl 3-[(4-methoxybenzoyl)amino]pyrazine-2-carboxylate.
| Compound Name | methyl 3-[(4-methoxybenzoyl)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 53485391 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl 3-[(4-methoxybenzoyl)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nccnc1NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H13N3O4/c1-20-10-5-3-9(4-6-10)13(18)17-12-11(14(19)21-2)15-7-8-16-12/h3-8H,1-2H3,(H,16,17,18) |
| InChIKey | COHPXUMMFWOEKJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |