About 2,5-diiodothieno[3,2-b]thiophene
2,5-diiodothieno[3,2-b]thiophene (PubChem CID 53485549) has the molecular formula C6H2I2S2
and a molecular weight of 392.02 g/mol. Its IUPAC name is 2,5-diiodothieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 2,5-diiodothieno[3,2-b]thiophene |
| PubChem CID | 53485549 |
| Molecular Formula | C6H2I2S2 |
| Molecular Weight | 392.02 g/mol |
| Exact Mass | 391.77 |
| IUPAC Name | 2,5-diiodothieno[3,2-b]thiophene |
| SMILES | Ic1cc2sc(I)cc2s1 |
| InChI | InChI=1S/C6H2I2S2/c7-5-1-3-4(10-5)2-6(8)9-3/h1-2H |
| InChIKey | FGVZUZZFMFYLOB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.02 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diiodothieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diiodothieno[3,2-b]thiophene?
The IUPAC name of 2,5-diiodothieno[3,2-b]thiophene (CID 53485549) is 2,5-diiodothieno[3,2-b]thiophene.
What is the SMILES notation for 2,5-diiodothieno[3,2-b]thiophene?
The canonical SMILES for 2,5-diiodothieno[3,2-b]thiophene is Ic1cc2sc(I)cc2s1.
What is the InChIKey of 2,5-diiodothieno[3,2-b]thiophene?
The InChIKey is FGVZUZZFMFYLOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2I2S2/c7-5-1-3-4(10-5)2-6(8)9-3/h1-2H.
What are the key properties of 2,5-diiodothieno[3,2-b]thiophene?
2,5-diiodothieno[3,2-b]thiophene has a molecular weight of 392.02 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diiodothieno[3,2-b]thiophene is sourced from PubChem (CID 53485549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).