C14H25F5OS — CID 53486377
9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-ol (PubChem CID 53486377) has the molecular formula C14H25F5OS and a molecular weight of 336.41 g/mol. Its IUPAC name is 9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-ol.
| Compound Name | 9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-ol |
|---|---|
| PubChem CID | 53486377 |
| Molecular Formula | C14H25F5OS |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-ol |
| SMILES | OCCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H25F5OS/c15-13(16,14(17,18)19)9-8-12-21-11-7-5-3-1-2-4-6-10-20/h20H,1-12H2 |
| InChIKey | AZSKACXKBRDCBY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|