About dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene
dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene (PubChem CID 53486413) has the molecular formula C20H18Cl2Zr
and a molecular weight of 420.49 g/mol. Its IUPAC name is dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene.
Molecular Properties
| Compound Name | dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene |
| PubChem CID | 53486413 |
| Molecular Formula | C20H18Cl2Zr |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene |
| SMILES | C1=CC(CCC2C=Cc3ccccc32)c2ccccc21.Cl[Zr]Cl |
| InChI | InChI=1S/C20H18.2ClH.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h1-12,17-18H,13-14H2;2*1H;/q;;;+2/p-2 |
| InChIKey | IJSDUKZKUCXMRL-UHFFFAOYSA-L |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene?
The IUPAC name of dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene (CID 53486413) is dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene.
What is the SMILES notation for dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene?
The canonical SMILES for dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene is C1=CC(CCC2C=Cc3ccccc32)c2ccccc21.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene?
The InChIKey is IJSDUKZKUCXMRL-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H18.2ClH.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h1-12,17-18H,13-14H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene?
dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene has a molecular weight of 420.49 g/mol, XLogP of 6.76, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene is sourced from PubChem (CID 53486413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).