C15H16BrClO2 — CID 53486604
ethyl (2Z,4Z)-2-(bromomethyl)-5-chloro-5-(4-methylphenyl)penta-2,4-dienoate (PubChem CID 53486604) has the molecular formula C15H16BrClO2 and a molecular weight of 343.65 g/mol. Its IUPAC name is ethyl (2Z,4Z)-2-(bromomethyl)-5-chloro-5-(4-methylphenyl)penta-2,4-dienoate.
| Compound Name | ethyl (2Z,4Z)-2-(bromomethyl)-5-chloro-5-(4-methylphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 53486604 |
| Molecular Formula | C15H16BrClO2 |
| Molecular Weight | 343.65 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | ethyl (2Z,4Z)-2-(bromomethyl)-5-chloro-5-(4-methylphenyl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C/C=C(\Cl)c1ccc(C)cc1)CBr |
| InChI | InChI=1S/C15H16BrClO2/c1-3-19-15(18)13(10-16)8-9-14(17)12-6-4-11(2)5-7-12/h4-9H,3,10H2,1-2H3/b13-8+,14-9- |
| InChIKey | XFHIXSWVWUDYEJ-MGDWIPCISA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|