C30H32N2O10 — CID 5348700
2-phenyl-2-[[(Z)-2-[(3,4,5-trimethoxybenzoyl)amino]-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]acetic acid (PubChem CID 5348700) has the molecular formula C30H32N2O10 and a molecular weight of 580.59 g/mol. Its IUPAC name is 2-phenyl-2-[[(Z)-2-[(3,4,5-trimethoxybenzoyl)amino]-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-phenyl-2-[[(Z)-2-[(3,4,5-trimethoxybenzoyl)amino]-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 5348700 |
| Molecular Formula | C30H32N2O10 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 2-phenyl-2-[[(Z)-2-[(3,4,5-trimethoxybenzoyl)amino]-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]acetic acid |
| SMILES | COc1cc(/C=C(\NC(=O)c2cc(OC)c(OC)c(OC)c2)C(=O)NC(C(=O)O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C30H32N2O10/c1-37-21-13-17(14-22(38-2)26(21)41-5)12-20(29(34)32-25(30(35)36)18-10-8-7-9-11-18)31-28(33)19-15-23(39-3)27(42-6)24(16-19)40-4/h7-16,25H,1-6H3,(H,31,33)(H,32,34)(H,35,36)/b20-12- |
| InChIKey | UKYXXPGGDYNYCY-NDENLUEZSA-N |
| XLogP | 3.45 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|