About thieno[2,3-d]pyridazine;dihydrochloride
thieno[2,3-d]pyridazine;dihydrochloride (PubChem CID 53487086) has the molecular formula C6H6Cl2N2S
and a molecular weight of 209.10 g/mol. Its IUPAC name is thieno[2,3-d]pyridazine;dihydrochloride.
Molecular Properties
| Compound Name | thieno[2,3-d]pyridazine;dihydrochloride |
| PubChem CID | 53487086 |
| Molecular Formula | C6H6Cl2N2S |
| Molecular Weight | 209.10 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | thieno[2,3-d]pyridazine;dihydrochloride |
| SMILES | Cl.Cl.c1cc2cnncc2s1 |
| InChI | InChI=1S/C6H4N2S.2ClH/c1-2-9-6-4-8-7-3-5(1)6;;/h1-4H;2*1H |
| InChIKey | GATMKRKFEONIRT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.10 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[2,3-d]pyridazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-d]pyridazine;dihydrochloride?
The IUPAC name of thieno[2,3-d]pyridazine;dihydrochloride (CID 53487086) is thieno[2,3-d]pyridazine;dihydrochloride.
What is the SMILES notation for thieno[2,3-d]pyridazine;dihydrochloride?
The canonical SMILES for thieno[2,3-d]pyridazine;dihydrochloride is Cl.Cl.c1cc2cnncc2s1.
What is the InChIKey of thieno[2,3-d]pyridazine;dihydrochloride?
The InChIKey is GATMKRKFEONIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2S.2ClH/c1-2-9-6-4-8-7-3-5(1)6;;/h1-4H;2*1H.
What are the key properties of thieno[2,3-d]pyridazine;dihydrochloride?
thieno[2,3-d]pyridazine;dihydrochloride has a molecular weight of 209.10 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-d]pyridazine;dihydrochloride is sourced from PubChem (CID 53487086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).