C28H32N2O3 — CID 53487169
benzyl N-[1-(1-hydroxy-1-phenylpropan-2-yl)piperidin-4-yl]-N-phenylcarbamate (PubChem CID 53487169) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is benzyl N-[1-(1-hydroxy-1-phenylpropan-2-yl)piperidin-4-yl]-N-phenylcarbamate.
| Compound Name | benzyl N-[1-(1-hydroxy-1-phenylpropan-2-yl)piperidin-4-yl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 53487169 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | benzyl N-[1-(1-hydroxy-1-phenylpropan-2-yl)piperidin-4-yl]-N-phenylcarbamate |
| SMILES | CC(C(O)c1ccccc1)N1CCC(N(C(=O)OCc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H32N2O3/c1-22(27(31)24-13-7-3-8-14-24)29-19-17-26(18-20-29)30(25-15-9-4-10-16-25)28(32)33-21-23-11-5-2-6-12-23/h2-16,22,26-27,31H,17-21H2,1H3 |
| InChIKey | LFQIYONICSBQHG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |