About N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide
N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 53487463) has the molecular formula C12H27NO2S
and a molecular weight of 249.42 g/mol. Its IUPAC name is N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 53487463 |
| Molecular Formula | C12H27NO2S |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[C@@H](O)C[C@H](NS(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C12H27NO2S/c1-7-10(14)8-11(9(2)3)13-16(15)12(4,5)6/h9-11,13-14H,7-8H2,1-6H3/t10-,11+,16?/m1/s1 |
| InChIKey | XUZXKHKAPISZPA-GPNPANDRSA-N |
| XLogP | 2.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide (CID 53487463) is N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide is CC[C@@H](O)C[C@H](NS(=O)C(C)(C)C)C(C)C.
What is the InChIKey of N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide?
The InChIKey is XUZXKHKAPISZPA-GPNPANDRSA-N. The full InChI is InChI=1S/C12H27NO2S/c1-7-10(14)8-11(9(2)3)13-16(15)12(4,5)6/h9-11,13-14H,7-8H2,1-6H3/t10-,11+,16?/m1/s1.
What are the key properties of N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide?
N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide has a molecular weight of 249.42 g/mol, XLogP of 2.22, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,5R)-5-hydroxy-2-methylheptan-3-yl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 53487463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).