About N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide
N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 53487636) has the molecular formula C13H29NO2S
and a molecular weight of 263.45 g/mol. Its IUPAC name is N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 53487636 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[C@@H](O)C[C@@H](NS(=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29NO2S/c1-8-10(15)9-11(12(2,3)4)14-17(16)13(5,6)7/h10-11,14-15H,8-9H2,1-7H3/t10-,11-,17?/m1/s1 |
| InChIKey | GBJFYHDOLJQXNN-CSKHJBKKSA-N |
| XLogP | 2.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide (CID 53487636) is N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide is CC[C@@H](O)C[C@@H](NS(=O)C(C)(C)C)C(C)(C)C.
What is the InChIKey of N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide?
The InChIKey is GBJFYHDOLJQXNN-CSKHJBKKSA-N. The full InChI is InChI=1S/C13H29NO2S/c1-8-10(15)9-11(12(2,3)4)14-17(16)13(5,6)7/h10-11,14-15H,8-9H2,1-7H3/t10-,11-,17?/m1/s1.
What are the key properties of N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide?
N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide has a molecular weight of 263.45 g/mol, XLogP of 2.61, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,5R)-5-hydroxy-2,2-dimethylheptan-3-yl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 53487636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).