About 2-bromo-9,9-bis(trifluoromethyl)fluorene
2-bromo-9,9-bis(trifluoromethyl)fluorene (PubChem CID 53487913) has the molecular formula C15H7BrF6
and a molecular weight of 381.11 g/mol. Its IUPAC name is 2-bromo-9,9-bis(trifluoromethyl)fluorene.
Molecular Properties
| Compound Name | 2-bromo-9,9-bis(trifluoromethyl)fluorene |
| PubChem CID | 53487913 |
| Molecular Formula | C15H7BrF6 |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 2-bromo-9,9-bis(trifluoromethyl)fluorene |
| SMILES | FC(F)(F)C1(C(F)(F)F)c2ccccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C15H7BrF6/c16-8-5-6-10-9-3-1-2-4-11(9)13(12(10)7-8,14(17,18)19)15(20,21)22/h1-7H |
| InChIKey | QKPPIGNALJLGKH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-9,9-bis(trifluoromethyl)fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-9,9-bis(trifluoromethyl)fluorene?
The IUPAC name of 2-bromo-9,9-bis(trifluoromethyl)fluorene (CID 53487913) is 2-bromo-9,9-bis(trifluoromethyl)fluorene.
What is the SMILES notation for 2-bromo-9,9-bis(trifluoromethyl)fluorene?
The canonical SMILES for 2-bromo-9,9-bis(trifluoromethyl)fluorene is FC(F)(F)C1(C(F)(F)F)c2ccccc2-c2ccc(Br)cc21.
What is the InChIKey of 2-bromo-9,9-bis(trifluoromethyl)fluorene?
The InChIKey is QKPPIGNALJLGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7BrF6/c16-8-5-6-10-9-3-1-2-4-11(9)13(12(10)7-8,14(17,18)19)15(20,21)22/h1-7H.
What are the key properties of 2-bromo-9,9-bis(trifluoromethyl)fluorene?
2-bromo-9,9-bis(trifluoromethyl)fluorene has a molecular weight of 381.11 g/mol, XLogP of 5.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-9,9-bis(trifluoromethyl)fluorene is sourced from PubChem (CID 53487913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).