About 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride
4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride (PubChem CID 53488019) has the molecular formula C9H18Cl2F2N2
and a molecular weight of 263.16 g/mol. Its IUPAC name is 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride.
Molecular Properties
| Compound Name | 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride |
| PubChem CID | 53488019 |
| Molecular Formula | C9H18Cl2F2N2 |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride |
| SMILES | Cl.Cl.FC1(F)CCN(C2CCNCC2)C1 |
| InChI | InChI=1S/C9H16F2N2.2ClH/c10-9(11)3-6-13(7-9)8-1-4-12-5-2-8;;/h8,12H,1-7H2;2*1H |
| InChIKey | KAMWXMDDOJQUNV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride?
The IUPAC name of 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride (CID 53488019) is 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride.
What is the SMILES notation for 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride?
The canonical SMILES for 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride is Cl.Cl.FC1(F)CCN(C2CCNCC2)C1.
What is the InChIKey of 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride?
The InChIKey is KAMWXMDDOJQUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2.2ClH/c10-9(11)3-6-13(7-9)8-1-4-12-5-2-8;;/h8,12H,1-7H2;2*1H.
What are the key properties of 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride?
4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride has a molecular weight of 263.16 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluoropyrrolidin-1-yl)piperidine;dihydrochloride is sourced from PubChem (CID 53488019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).