About [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate
[2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate (PubChem CID 5348810) has the molecular formula C17H16N4O4S
and a molecular weight of 372.41 g/mol. Its IUPAC name is [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate.
Molecular Properties
| Compound Name | [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate |
| PubChem CID | 5348810 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate |
| SMILES | CCOc1cc(/C=N/n2cnnc2)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N4O4S/c1-2-24-17-10-14(11-20-21-12-18-19-13-21)8-9-16(17)25-26(22,23)15-6-4-3-5-7-15/h3-13H,2H2,1H3/b20-11+ |
| InChIKey | VPCDFJXYMFHEFS-RGVLZGJSSA-N |
| XLogP | 2.33 |
| TPSA | 95.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate?
The IUPAC name of [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate (CID 5348810) is [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate.
What is the SMILES notation for [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate?
The canonical SMILES for [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate is CCOc1cc(/C=N/n2cnnc2)ccc1OS(=O)(=O)c1ccccc1.
What is the InChIKey of [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate?
The InChIKey is VPCDFJXYMFHEFS-RGVLZGJSSA-N. The full InChI is InChI=1S/C17H16N4O4S/c1-2-24-17-10-14(11-20-21-12-18-19-13-21)8-9-16(17)25-26(22,23)15-6-4-3-5-7-15/h3-13H,2H2,1H3/b20-11+.
What are the key properties of [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate?
[2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate has a molecular weight of 372.41 g/mol, XLogP of 2.33, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] benzenesulfonate is sourced from PubChem (CID 5348810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).