1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid

C10H7F2N3O2 — CID 53489648

IUPAC1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid
SMILESO=C(O)c1cn(Cc2ccc(F)cc2F)nn1
InChIInChI=1S/C10H7F2N3O2/c11-7-2-1-6(8(12)3-7)4-15-5-9(10(16)17)13-14-15/h1-3,5H,4H2,(H,16,17)
InChIKeyIJJHBOIWBJWGHW-UHFFFAOYSA-N
MW239.18 g/mol
LogP1.30
Rot. Bonds3

About 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid

1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid (PubChem CID 53489648) has the molecular formula C10H7F2N3O2 and a molecular weight of 239.18 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid.

Molecular Properties

Compound Name1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid
PubChem CID53489648
Molecular FormulaC10H7F2N3O2
Molecular Weight239.18 g/mol
Exact Mass239.05
IUPAC Name1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid
SMILESO=C(O)c1cn(Cc2ccc(F)cc2F)nn1
InChIInChI=1S/C10H7F2N3O2/c11-7-2-1-6(8(12)3-7)4-15-5-9(10(16)17)13-14-15/h1-3,5H,4H2,(H,16,17)
InChIKeyIJJHBOIWBJWGHW-UHFFFAOYSA-N
XLogP1.30
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.18
LogP ≤ 51.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid (CID 53489648) is 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid is O=C(O)c1cn(Cc2ccc(F)cc2F)nn1.
What is the InChIKey of 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid?
The InChIKey is IJJHBOIWBJWGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2N3O2/c11-7-2-1-6(8(12)3-7)4-15-5-9(10(16)17)13-14-15/h1-3,5H,4H2,(H,16,17).
What are the key properties of 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid?
1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid has a molecular weight of 239.18 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-difluorophenyl)methyl]triazole-4-carboxylic acid is sourced from PubChem (CID 53489648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).