C17H24N4O2S — CID 53490633
5-(4-methylphenyl)sulfonyl-2-N,2-N-dipropylpyrimidine-2,4-diamine (PubChem CID 53490633) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-2-N,2-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 5-(4-methylphenyl)sulfonyl-2-N,2-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 53490633 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-2-N,2-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCN(CCC)c1ncc(S(=O)(=O)c2ccc(C)cc2)c(N)n1 |
| InChI | InChI=1S/C17H24N4O2S/c1-4-10-21(11-5-2)17-19-12-15(16(18)20-17)24(22,23)14-8-6-13(3)7-9-14/h6-9,12H,4-5,10-11H2,1-3H3,(H2,18,19,20) |
| InChIKey | JOKVVNFLKBNUKL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |