About 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine
2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine (PubChem CID 53490773) has the molecular formula C15H20N4O2S
and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine |
| PubChem CID | 53490773 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1ncc(S(=O)(=O)c2cccc(C)c2)c(N)n1 |
| InChI | InChI=1S/C15H20N4O2S/c1-4-19(5-2)15-17-10-13(14(16)18-15)22(20,21)12-8-6-7-11(3)9-12/h6-10H,4-5H2,1-3H3,(H2,16,17,18) |
| InChIKey | GBRFATAXEXXHKF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine?
The IUPAC name of 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine (CID 53490773) is 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine.
What is the SMILES notation for 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine?
The canonical SMILES for 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine is CCN(CC)c1ncc(S(=O)(=O)c2cccc(C)c2)c(N)n1.
What is the InChIKey of 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine?
The InChIKey is GBRFATAXEXXHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O2S/c1-4-19(5-2)15-17-10-13(14(16)18-15)22(20,21)12-8-6-7-11(3)9-12/h6-10H,4-5H2,1-3H3,(H2,16,17,18).
What are the key properties of 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine?
2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine has a molecular weight of 320.42 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-diethyl-5-(3-methylphenyl)sulfonylpyrimidine-2,4-diamine is sourced from PubChem (CID 53490773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).