C24H28N4O4S — CID 53490927
N-(4-ethylphenyl)-2-[6-(2-methylpiperidin-1-yl)sulfonyl-2-oxoquinazolin-1-yl]acetamide (PubChem CID 53490927) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[6-(2-methylpiperidin-1-yl)sulfonyl-2-oxoquinazolin-1-yl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[6-(2-methylpiperidin-1-yl)sulfonyl-2-oxoquinazolin-1-yl]acetamide |
|---|---|
| PubChem CID | 53490927 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-(4-ethylphenyl)-2-[6-(2-methylpiperidin-1-yl)sulfonyl-2-oxoquinazolin-1-yl]acetamide |
| SMILES | CCc1ccc(NC(=O)Cn2c(=O)ncc3cc(S(=O)(=O)N4CCCCC4C)ccc32)cc1 |
| InChI | InChI=1S/C24H28N4O4S/c1-3-18-7-9-20(10-8-18)26-23(29)16-27-22-12-11-21(14-19(22)15-25-24(27)30)33(31,32)28-13-5-4-6-17(28)2/h7-12,14-15,17H,3-6,13,16H2,1-2H3,(H,26,29) |
| InChIKey | QXNFKELGDVLQTN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |