C17H10BrF3N2O3 — CID 53491067
6-bromo-2-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-quinoline-4-carboxamide (PubChem CID 53491067) has the molecular formula C17H10BrF3N2O3 and a molecular weight of 427.18 g/mol. Its IUPAC name is 6-bromo-2-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-quinoline-4-carboxamide.
| Compound Name | 6-bromo-2-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 53491067 |
| Molecular Formula | C17H10BrF3N2O3 |
| Molecular Weight | 427.18 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 6-bromo-2-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1cc(=O)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C17H10BrF3N2O3/c18-9-1-6-14-12(7-9)13(8-15(24)23-14)16(25)22-10-2-4-11(5-3-10)26-17(19,20)21/h1-8H,(H,22,25)(H,23,24) |
| InChIKey | NWKFMZUQBYIWGP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |