C18H17ClN4O — CID 53491086
1-[(4-aminophenyl)methyl]-N-(3-chloro-4-methylphenyl)imidazole-4-carboxamide (PubChem CID 53491086) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methyl]-N-(3-chloro-4-methylphenyl)imidazole-4-carboxamide.
| Compound Name | 1-[(4-aminophenyl)methyl]-N-(3-chloro-4-methylphenyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 53491086 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-[(4-aminophenyl)methyl]-N-(3-chloro-4-methylphenyl)imidazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cn(Cc3ccc(N)cc3)cn2)cc1Cl |
| InChI | InChI=1S/C18H17ClN4O/c1-12-2-7-15(8-16(12)19)22-18(24)17-10-23(11-21-17)9-13-3-5-14(20)6-4-13/h2-8,10-11H,9,20H2,1H3,(H,22,24) |
| InChIKey | ZJYKQKKFVSMKMI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|